Difference between revisions of "10-FORMYL-DIHYDROFOLATE-GLU-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24186 == == Reaction(s) known to consume the compound == * RXN-22203 == Reaction(s) known to produce the compound == * RXN-2219...") |
(Created page with "Category:metabolite == Metabolite CPD-15689 == * common-name: ** (2e,5e)-dodeca-2,5-dienoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15689 == |
+ | * common-name: | ||
+ | ** (2e,5e)-dodeca-2,5-dienoyl-coa | ||
+ | * smiles: | ||
+ | ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** zsjrxhrcabosnc-uovvplbnsa-j | ||
+ | * molecular-weight: | ||
+ | ** 941.776 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14801]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=(2e,5e)-dodeca-2,5-dienoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=zsjrxhrcabosnc-uovvplbnsa-j}} | ||
+ | {{#set: molecular-weight=941.776}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-15689
- common-name:
- (2e,5e)-dodeca-2,5-dienoyl-coa
- smiles:
- ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- zsjrxhrcabosnc-uovvplbnsa-j
- molecular-weight:
- 941.776