Difference between revisions of "10-FORMYL-THF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8202 == * common-name: ** a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine == Reaction(s) known to consume...")
(Created page with "Category:metabolite == Metabolite CPD-558 == * common-name: ** pimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8202 ==
+
== Metabolite CPD-558 ==
 
* common-name:
 
* common-name:
** a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine
+
** pimeloyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** lycrxmtyuzduga-uyrkptjqsa-i
 +
* molecular-weight:
 +
** 904.649
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.134-RXN]]
+
* [[7KAPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine}}
+
{{#set: common-name=pimeloyl-coa}}
 +
{{#set: inchi-key=inchikey=lycrxmtyuzduga-uyrkptjqsa-i}}
 +
{{#set: molecular-weight=904.649}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-558

  • common-name:
    • pimeloyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lycrxmtyuzduga-uyrkptjqsa-i
  • molecular-weight:
    • 904.649

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality