Difference between revisions of "10-FORMYL-THF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-558 == * common-name: ** pimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[...")
(Created page with "Category:metabolite == Metabolite 10-FORMYL-THF == * common-name: ** 10-formyl-tetrahydrofolate mono-l-glutamate * smiles: ** c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc(...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-558 ==
+
== Metabolite 10-FORMYL-THF ==
 
* common-name:
 
* common-name:
** pimeloyl-coa
+
** 10-formyl-tetrahydrofolate mono-l-glutamate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))nc3(c(=o)nc(n)=nc(n2)=3))
 
* inchi-key:
 
* inchi-key:
** lycrxmtyuzduga-uyrkptjqsa-i
+
** aufgtpparqzwdo-ypmhnxcesa-l
 
* molecular-weight:
 
* molecular-weight:
** 904.649
+
** 471.429
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[7KAPSYN-RXN]]
+
* [[FPAIF]]
 +
* [[FPGFTh]]
 +
* [[FTHDF]]
 +
* [[MTHFCx]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[FPAIF]]
 +
* [[FPGFTh]]
 +
* [[FTHFL]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pimeloyl-coa}}
+
{{#set: common-name=10-formyl-tetrahydrofolate mono-l-glutamate}}
{{#set: inchi-key=inchikey=lycrxmtyuzduga-uyrkptjqsa-i}}
+
{{#set: inchi-key=inchikey=aufgtpparqzwdo-ypmhnxcesa-l}}
{{#set: molecular-weight=904.649}}
+
{{#set: molecular-weight=471.429}}

Latest revision as of 11:13, 18 March 2021

Metabolite 10-FORMYL-THF

  • common-name:
    • 10-formyl-tetrahydrofolate mono-l-glutamate
  • smiles:
    • c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))nc3(c(=o)nc(n)=nc(n2)=3))
  • inchi-key:
    • aufgtpparqzwdo-ypmhnxcesa-l
  • molecular-weight:
    • 471.429

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality