Difference between revisions of "10-FORMYL-THF"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-B == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=...") |
(Created page with "Category:metabolite == Metabolite CPD-13518 == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+])ccc([n+])c([o-])=o * inchi-key: ** fqwravymzulpnk-b...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13518 == |
| + | * common-name: | ||
| + | ** nω-hydroxy-l-arginine | ||
* smiles: | * smiles: | ||
| − | ** c | + | ** c(nc(no)=[n+])ccc([n+])c([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** fqwravymzulpnk-bypyzucnsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 191.209 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13565]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13564]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nω-hydroxy-l-arginine}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}} |
| + | {{#set: molecular-weight=191.209}} | ||
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-13518
- common-name:
- nω-hydroxy-l-arginine
- smiles:
- c(nc(no)=[n+])ccc([n+])c([o-])=o
- inchi-key:
- fqwravymzulpnk-bypyzucnsa-o
- molecular-weight:
- 191.209
