Difference between revisions of "11Z-3-oxo-icos-11-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13665 == * common-name: ** n-acetyl-d-glucosamine 6-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-19159 == * common-name: ** (s)-3-hydroxy-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13665 ==
+
== Metabolite CPD-19159 ==
 
* common-name:
 
* common-name:
** n-acetyl-d-glucosamine 6-sulfate
+
** (s)-3-hydroxy-(11z)-octadecenoyl-coa
 
* smiles:
 
* smiles:
** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1)
+
** ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** wjfveeaiyioath-rtrlpjtcsa-m
+
** scdxbwnpjageek-kboaxvdlsa-j
 
* molecular-weight:
 
* molecular-weight:
** 300.26
+
** 1043.952
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16512]]
+
* [[RXN-17786]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16512]]
+
* [[RXN-17785]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-d-glucosamine 6-sulfate}}
+
{{#set: common-name=(s)-3-hydroxy-(11z)-octadecenoyl-coa}}
{{#set: inchi-key=inchikey=wjfveeaiyioath-rtrlpjtcsa-m}}
+
{{#set: inchi-key=inchikey=scdxbwnpjageek-kboaxvdlsa-j}}
{{#set: molecular-weight=300.26}}
+
{{#set: molecular-weight=1043.952}}

Revision as of 08:29, 15 March 2021

Metabolite CPD-19159

  • common-name:
    • (s)-3-hydroxy-(11z)-octadecenoyl-coa
  • smiles:
    • ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • scdxbwnpjageek-kboaxvdlsa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality