Difference between revisions of "11Z-icos-11-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Fatty-Acids == * common-name: ** a fatty acid == Reaction(s) known to consume the compound == * BUTYRATE--COA-LIGASE-RXN == Reaction(...") |
(Created page with "Category:metabolite == Metabolite LINOLENIC_ACID == * common-name: ** α-linolenate * smiles: ** ccc=ccc=ccc=ccccccccc(=o)[o-] * inchi-key: ** dtosiqbpprvqhs-pdbxooch...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LINOLENIC_ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-linolenate |
| + | * smiles: | ||
| + | ** ccc=ccc=ccc=ccccccccc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** dtosiqbpprvqhs-pdbxoochsa-m | ||
| + | * molecular-weight: | ||
| + | ** 277.426 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[LINOLENOYL-RXN]] |
| + | * [[LNLNCACOAL]] | ||
| + | * [[RXN-1321]] | ||
| + | * [[RXN-8497]] | ||
| + | * [[llcoas]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1501_METACYC18.5]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-linolenate}} |
| + | {{#set: inchi-key=inchikey=dtosiqbpprvqhs-pdbxoochsa-m}} | ||
| + | {{#set: molecular-weight=277.426}} | ||
Revision as of 08:25, 15 March 2021
Contents
Metabolite LINOLENIC_ACID
- common-name:
- α-linolenate
- smiles:
- ccc=ccc=ccc=ccccccccc(=o)[o-]
- inchi-key:
- dtosiqbpprvqhs-pdbxoochsa-m
- molecular-weight:
- 277.426
