Difference between revisions of "11Z-icos-11-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LINOLENIC_ACID == * common-name: ** α-linolenate * smiles: ** ccc=ccc=ccc=ccccccccc(=o)[o-] * inchi-key: ** dtosiqbpprvqhs-pdbxooch...") |
(Created page with "Category:metabolite == Metabolite 11Z-icos-11-enoyl-ACPs == * common-name: ** a gondoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 11Z-icos-11-enoyl-ACPs == |
* common-name: | * common-name: | ||
− | ** | + | ** a gondoyl-[acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16632]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a gondoyl-[acp]}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 11Z-icos-11-enoyl-ACPs
- common-name:
- a gondoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a gondoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.