Difference between revisions of "12-EPOXYPROPANE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate * smiles: ** c(op([o-])...")
(Created page with "Category:metabolite == Metabolite 1-KETO-2-METHYLVALERATE == * common-name: ** (r)-2,3-dihydroxy-3-methylpentanoate * smiles: ** ccc(o)(c)c(c([o-])=o)o * inchi-key: ** pdg...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE ==
+
== Metabolite 1-KETO-2-METHYLVALERATE ==
 
* common-name:
 
* common-name:
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
+
** (r)-2,3-dihydroxy-3-methylpentanoate
 
* smiles:
 
* smiles:
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
+
** ccc(o)(c)c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** xfvulmdjzxymsg-ziyngmlesa-k
+
** pdgxjdxvgmhuir-ujursfkzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 336.174
+
** 147.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
* [[SAICARSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[ACETOOHBUTREDUCTOISOM-RXN]]
 +
* [[KARI_LPAREN_23dhmp_RPAREN_]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}}
+
{{#set: common-name=(r)-2,3-dihydroxy-3-methylpentanoate}}
{{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}}
+
{{#set: inchi-key=inchikey=pdgxjdxvgmhuir-ujursfkzsa-m}}
{{#set: molecular-weight=336.174}}
+
{{#set: molecular-weight=147.15}}

Revision as of 13:12, 14 January 2021

Metabolite 1-KETO-2-METHYLVALERATE

  • common-name:
    • (r)-2,3-dihydroxy-3-methylpentanoate
  • smiles:
    • ccc(o)(c)c(c([o-])=o)o
  • inchi-key:
    • pdgxjdxvgmhuir-ujursfkzsa-m
  • molecular-weight:
    • 147.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality