Difference between revisions of "13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FADH2 == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c...")
(Created page with "Category:metabolite == Metabolite Aryl-beta-D-Glucosides == * common-name: ** an aryl β-d-glucoside == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FADH2 ==
+
== Metabolite Aryl-beta-D-Glucosides ==
 
* common-name:
 
* common-name:
** fadh2
+
** an aryl β-d-glucoside
* smiles:
 
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
 
* inchi-key:
 
** ypzrhbjkemoyqh-uybvjogssa-l
 
* molecular-weight:
 
** 785.556
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACOAD1f]]
 
* [[PPCOAOm]]
 
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOA120OR]]
+
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
* [[ACOA140OR]]
 
* [[ACOA160OR]]
 
* [[ACOA40OR]]
 
* [[ACOA80OR]]
 
* [[ACOAD1f]]
 
* [[IVCDH]]
 
* [[MCDH]]
 
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
* [[PPCOAOm]]
 
* [[RXN-14264]]
 
* [[SUCDHm]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fadh2}}
+
{{#set: common-name=an aryl β-d-glucoside}}
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
 
{{#set: molecular-weight=785.556}}
 

Revision as of 13:08, 14 January 2021

Metabolite Aryl-beta-D-Glucosides

  • common-name:
    • an aryl β-d-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality