Difference between revisions of "13-HYDROPEROXYOCTADECA-911-DIENOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-220 RXN1G-220] == * direction: ** left-to-right * common-name: ** cis,cis-delta17,35-3-hydrox...")
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-220 RXN1G-220] ==
+
== Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** cis,cis-delta17,35-3-hydroxyc54:2-[acyl-carrier protein] dehydratase
+
** (13s)-hpode
−
** 3-cis,cis-delta17,35-3-hydroxyc54:2-[acyl-carrier protein] dehydratase
+
* smiles:
−
* ec-number:
+
** cccccc(c=cc=ccccccccc(=o)[o-])oo
−
** [http://enzyme.expasy.org/EC/4.2.1.m2 ec-4.2.1.m2]
+
* inchi-key:
−
== Reaction formula ==
+
** jdsrhvwsamtssn-irqzeampsa-m
−
* 1 [[cis-cis-D17-35-3-hydroxyC54-2-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[trans-D2-cis-cis-D17-35-C54-3-ACPs]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 311.44
−
* Gene: [[SJ10275]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[LIPOXYGENASE-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
{{#set: common-name=(13s)-hpode}}
−
** '''26''' reactions found over '''182''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=jdsrhvwsamtssn-irqzeampsa-m}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=311.44}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-cis,cis-delta17,35-3-hydroxyc54:2-[acyl-carrier protein] dehydratase|cis,cis-delta17,35-3-hydroxyc54:2-[acyl-carrier protein] dehydratase}}
 
−
{{#set: ec-number=ec-4.2.1.m2}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE

  • common-name:
    • (13s)-hpode
  • smiles:
    • cccccc(c=cc=ccccccccc(=o)[o-])oo
  • inchi-key:
    • jdsrhvwsamtssn-irqzeampsa-m
  • molecular-weight:
    • 311.44

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=13-HYDROPEROXYOCTADECA-911-DIENOATE&oldid=138711"