Difference between revisions of "13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8158 == * common-name: ** 1-palmitoyl-2-linoleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)...") |
(Created page with "Category:metabolite == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == * common-name: ** 6-(hydroxymethyl)-7,8-dihydropterin * smiles: ** c(o)c2(=nc1(c(=o)nc(n)=nc=1...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 6-(hydroxymethyl)-7,8-dihydropterin |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cqqnnqtxugluev-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 195.18 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[H2NEOPTERINALDOL-RXN]] |
+ | * [[RXN-10857]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.18}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE
- common-name:
- 6-(hydroxymethyl)-7,8-dihydropterin
- smiles:
- c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2))
- inchi-key:
- cqqnnqtxugluev-uhfffaoysa-n
- molecular-weight:
- 195.18