Difference between revisions of "13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8158 == * common-name: ** 1-palmitoyl-2-linoleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)...")
(Created page with "Category:metabolite == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == * common-name: ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate * smiles: ** cccccc(=o)c=cc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-8158 ==
+
== Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 ==
 
* common-name:
 
* common-name:
−
** 1-palmitoyl-2-linoleoyl-phosphatidylcholine
+
** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
 
* smiles:
 
* smiles:
−
** cccccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(=o)([o-])occ[n+](c)(c)c
+
** cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
 
* inchi-key:
 
* inchi-key:
−
** jlpulhdhaoznqi-ztimhpmxsa-n
+
** vxpbdcbtmskckz-xqhnhvhjsa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 758.07
+
** 351.462
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12430]]
+
* [[1.1.1.197-RXN]]
−
* [[RXN-8361]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-8360]]
+
* [[1.1.1.197-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1-palmitoyl-2-linoleoyl-phosphatidylcholine}}
+
{{#set: common-name=(13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate}}
−
{{#set: inchi-key=inchikey=jlpulhdhaoznqi-ztimhpmxsa-n}}
+
{{#set: inchi-key=inchikey=vxpbdcbtmskckz-xqhnhvhjsa-m}}
−
{{#set: molecular-weight=758.07}}
+
{{#set: molecular-weight=351.462}}

Latest revision as of 11:18, 18 March 2021

Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1

  • common-name:
    • (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
  • smiles:
    • cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
  • inchi-key:
    • vxpbdcbtmskckz-xqhnhvhjsa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1&oldid=139766"