Difference between revisions of "13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCHLm HBCHLm] == * direction: ** reversible * common-name: ** 3-hydroxybutanoyl-coa hydro-lyase, m...")
(Created page with "Category:metabolite == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == * common-name: ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate * smiles: ** cccccc(=o)c=cc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCHLm HBCHLm] ==
+
== Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 3-hydroxybutanoyl-coa hydro-lyase, mitochondria
+
** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[S-3-HYDROXYBUTANOYL-COA]][m] '''<=>''' 1.0 [[CROTONYL-COA]][m] '''+''' 1.0 [[WATER]][m]
+
** cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ00040]]
+
** vxpbdcbtmskckz-xqhnhvhjsa-m
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 351.462
−
* Gene: [[SJ21390]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[1.1.1.197-RXN]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[1.1.1.197-RXN]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=(13e)-11-&alpha;-hydroxy-9,15-dioxoprost-13-enoate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=vxpbdcbtmskckz-xqhnhvhjsa-m}}
−
{{#set: direction=reversible}}
+
{{#set: molecular-weight=351.462}}
−
{{#set: common-name=3-hydroxybutanoyl-coa hydro-lyase, mitochondria}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1

  • common-name:
    • (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
  • smiles:
    • cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
  • inchi-key:
    • vxpbdcbtmskckz-xqhnhvhjsa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1&oldid=139766"