Difference between revisions of "13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-RXN LINOLENOYL-RXN] == * direction: ** left-to-right * common-name: ** long-chain fatty...") |
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CONIFERYL-ALCOHOL == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** coniferyl alcohol |
− | * | + | * smiles: |
− | + | ** coc1(=cc(c=cco)=cc=c(o)1) | |
− | ** | + | * inchi-key: |
− | == | + | ** jmfrwrfflbvwsi-nscuhmnnsa-n |
− | + | * molecular-weight: | |
− | + | ** 180.203 | |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[RXN-17351]] |
− | + | * [[RXN-17352]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=coniferyl alcohol}} | |
− | ** | + | {{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}} |
− | + | {{#set: molecular-weight=180.203}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:38, 18 December 2020
Contents
Metabolite CONIFERYL-ALCOHOL
- common-name:
- coniferyl alcohol
- smiles:
- coc1(=cc(c=cco)=cc=c(o)1)
- inchi-key:
- jmfrwrfflbvwsi-nscuhmnnsa-n
- molecular-weight:
- 180.203