Difference between revisions of "14-alpha-methylsteroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * smiles: ** c(op([o...")
(Created page with "Category:metabolite == Metabolite 14-alpha-methylsteroids == * common-name: ** a 14α-methylsteroid == Reaction(s) known to consume the compound == * RXN-13961 ==...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
+
== Metabolite 14-alpha-methylsteroids ==
 
* common-name:
 
* common-name:
−
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
+
** a 14α-methylsteroid
−
* smiles:
 
−
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
 
−
* inchi-key:
 
−
** naqghjtuzrhgac-lbgugvgysa-j
 
−
* molecular-weight:
 
−
** 450.255
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[AIAL]]
+
* [[RXN-13961]]
−
* [[AICARSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[AIAL]]
 
−
* [[AICARSYN-RXN]]
 
−
* [[SAICARSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
+
{{#set: common-name=a 14α-methylsteroid}}
−
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}
 
−
{{#set: molecular-weight=450.255}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 14-alpha-methylsteroids

  • common-name:
    • a 14α-methylsteroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=14-alpha-methylsteroids&oldid=136800"