Difference between revisions of "1516-DIHYDROBILIVERDIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10061 RXN-10061] == * direction: ** left-to-right * common-name: ** 3-hydroxycerotyl-[acp] dehy...")
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-key: ** mtvwfvdwrvydor-qmmmgpob...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10061 RXN-10061] ==
+
== Metabolite CPD-11878 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-hydroxycerotyl-[acp] dehydrase
+
** 3,4-dihydroxyphenylglycol
−
** (r)-3-hydroxycerotyl-[acp] dehydratase
+
* smiles:
−
* ec-number:
+
** c(o)c(o)c1(c=cc(o)=c(o)c=1)
−
** [http://enzyme.expasy.org/EC/4.2.1.59 ec-4.2.1.59]
+
* inchi-key:
−
== Reaction formula ==
+
** mtvwfvdwrvydor-qmmmgpobsa-n
−
* 1 [[R-3-hydroxycerotoyl-ACPs]][c] '''=>''' 1 [[Trans-D2-hexacos-2-enoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 170.165
−
* Gene: [[SJ10275]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10911]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6113]], superpathway of mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113]
+
{{#set: common-name=3,4-dihydroxyphenylglycol}}
−
** '''8''' reactions found over '''4''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=mtvwfvdwrvydor-qmmmgpobsa-n}}
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
{{#set: molecular-weight=170.165}}
−
** '''26''' reactions found over '''182''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=(r)-3-hydroxycerotyl-[acp] dehydratase|3-hydroxycerotyl-[acp] dehydrase}}
 
−
{{#set: ec-number=ec-4.2.1.59}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-11878

  • common-name:
    • 3,4-dihydroxyphenylglycol
  • smiles:
    • c(o)c(o)c1(c=cc(o)=c(o)c=1)
  • inchi-key:
    • mtvwfvdwrvydor-qmmmgpobsa-n
  • molecular-weight:
    • 170.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1516-DIHYDROBILIVERDIN&oldid=47599"