Difference between revisions of "1516-DIHYDROBILIVERDIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BIOTIN == * common-name: ** biotin * smiles: ** c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12)) * inchi-key: ** ybjhbahktgyvgt-zkwxmuahsa-m * m...")
(Created page with "Category:metabolite == Metabolite CPD-9867 == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BIOTIN ==
+
== Metabolite CPD-9867 ==
 
* common-name:
 
* common-name:
** biotin
+
** 3-(all-trans-decaprenyl)benzene-1,2-diol
 
* smiles:
 
* smiles:
** c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12))
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** ybjhbahktgyvgt-zkwxmuahsa-m
+
** caujtfnfoamxrt-xrbhbmlssa-n
 
* molecular-weight:
 
* molecular-weight:
** 243.3
+
** 791.294
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6.3.4.10-RXN]]
+
* [[RXN-9233]]
* [[6.3.4.11-RXN]]
 
* [[6.3.4.9-RXN]]
 
* [[BIOTINLIG-RXN]]
 
* [[ExchangeSeed-BIOTIN]]
 
* [[RXN0-7192]]
 
* [[TransportSeed-BIOTIN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.8.1.6-RXN]]
 
* [[ExchangeSeed-BIOTIN]]
 
* [[RXN-17473]]
 
* [[TransportSeed-BIOTIN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=biotin}}
+
{{#set: common-name=3-(all-trans-decaprenyl)benzene-1,2-diol}}
{{#set: inchi-key=inchikey=ybjhbahktgyvgt-zkwxmuahsa-m}}
+
{{#set: inchi-key=inchikey=caujtfnfoamxrt-xrbhbmlssa-n}}
{{#set: molecular-weight=243.3}}
+
{{#set: molecular-weight=791.294}}

Revision as of 18:57, 14 January 2021

Metabolite CPD-9867

  • common-name:
    • 3-(all-trans-decaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • caujtfnfoamxrt-xrbhbmlssa-n
  • molecular-weight:
    • 791.294

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality