Difference between revisions of "16S-rRNA-2-O-methylcytidine1402"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9451 == * common-name: ** 2-isopropylmaleate * smiles: ** cc(c(c(=o)[o-])=cc(=o)[o-])c * inchi-key: ** njmgrjlqrlfqqx-hyxafxhysa-l *...") |
(Created page with "Category:metabolite == Metabolite 16S-rRNA-2-O-methylcytidine1402 == * common-name: ** a 2'-o-methylcytidine1402 in 16s rrna == Reaction(s) known to consume the compound =...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 16S-rRNA-2-O-methylcytidine1402 == |
* common-name: | * common-name: | ||
| − | ** 2- | + | ** a 2'-o-methylcytidine1402 in 16s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11637]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=a 2'-o-methylcytidine1402 in 16s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 16S-rRNA-2-O-methylcytidine1402
- common-name:
- a 2'-o-methylcytidine1402 in 16s rrna
