Difference between revisions of "16S-rRNA-2-O-methylcytidine1402"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19165 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * DIHYDRONEOPTERIN-MONO-P-...")
(Created page with "Category:metabolite == Metabolite CPD-15368 == * common-name: ** 3-oxo-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19165 ==
+
== Metabolite CPD-15368 ==
−
== Organism(s) associated with this gene  ==
+
* common-name:
−
* [[S.japonica_carotenoid_curated]]
+
** 3-oxo-lesqueroloyl-coa
−
== Reaction(s) associated ==
+
* smiles:
−
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
−
** Category: [[orthology]]
+
* inchi-key:
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
** nqxrrzbozbkgiu-mhaufedzsa-j
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* molecular-weight:
−
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+
** 1085.989
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14493]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) associated ==
+
* [[RXN-14492]]
−
* [[PWY-6797]]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=3-oxo-lesqueroloyl-coa}}
−
* [[PWY-6147]]
+
{{#set: inchi-key=inchikey=nqxrrzbozbkgiu-mhaufedzsa-j}}
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
{{#set: molecular-weight=1085.989}}
−
* [[PWY-7539]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-15368

  • common-name:
    • 3-oxo-lesqueroloyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nqxrrzbozbkgiu-mhaufedzsa-j
  • molecular-weight:
    • 1085.989

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=16S-rRNA-2-O-methylcytidine1402&oldid=46762"