Difference between revisions of "16S-rRNA-N2methylguanine1516"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite VANILLYL_MANDELATE == * common-name: ** vanillyl mandelate * smiles: ** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-]) * inchi-key: ** cgqcwmiaepehnq-...") |
(Created page with "Category:metabolite == Metabolite 16S-rRNA-N2methylguanine1516 == * common-name: ** an n2-methylguanine1516 in 16s rrna == Reaction(s) known to consume the compound == ==...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 16S-rRNA-N2methylguanine1516 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n2-methylguanine1516 in 16s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-6731]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n2-methylguanine1516 in 16s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 16S-rRNA-N2methylguanine1516
- common-name:
- an n2-methylguanine1516 in 16s rrna
