Difference between revisions of "16S-rRNA-N3-methyluracil1498"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-Dephospho-DNA == * common-name: ** a 5'-dephospho-[dna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-HYDROXYL-K...") |
(Created page with "Category:metabolite == Metabolite CPD-11877 == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) * inchi-key: ** jwjctzkfygdabj-vifpvbqesa-o * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11877 == |
* common-name: | * common-name: | ||
− | ** | + | ** metanephrine |
+ | * smiles: | ||
+ | ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) | ||
+ | * inchi-key: | ||
+ | ** jwjctzkfygdabj-vifpvbqesa-o | ||
+ | * molecular-weight: | ||
+ | ** 198.241 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10913]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=metanephrine}} |
+ | {{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}} | ||
+ | {{#set: molecular-weight=198.241}} |
Revision as of 15:00, 5 January 2021
Contents
Metabolite CPD-11877
- common-name:
- metanephrine
- smiles:
- c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
- inchi-key:
- jwjctzkfygdabj-vifpvbqesa-o
- molecular-weight:
- 198.241