Difference between revisions of "16S-rRNA-N6-dimethyladenine1518-1519"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9873 == * common-name: ** 3-demethylubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite Tubulin-Heterodimers == * common-name: ** an α/β tubulin heterodimer == Reaction(s) known to consume the compound == == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9873 ==
+
== Metabolite Tubulin-Heterodimers ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-10
+
** an α/β tubulin heterodimer
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 
* inchi-key:
 
** vlmqnhnmqvlpqi-avrcvibksa-n
 
* molecular-weight:
 
** 851.347
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9237]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.6.4.3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-10}}
+
{{#set: common-name=an α/β tubulin heterodimer}}
{{#set: inchi-key=inchikey=vlmqnhnmqvlpqi-avrcvibksa-n}}
 
{{#set: molecular-weight=851.347}}
 

Revision as of 13:11, 14 January 2021

Metabolite Tubulin-Heterodimers

  • common-name:
    • an α/β tubulin heterodimer

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality