Difference between revisions of "16S-rRNA-N6-dimethyladenine1518-1519"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Tubulin-Heterodimers == * common-name: ** an α/β tubulin heterodimer == Reaction(s) known to consume the compound == == Reacti...") |
(Created page with "Category:metabolite == Metabolite GDP-L-GALACTOSE == * common-name: ** gdp-β-l-galactose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GDP-L-GALACTOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** gdp-β-l-galactose |
| + | * smiles: | ||
| + | ** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o | ||
| + | * inchi-key: | ||
| + | ** mvmscbbuihutgj-jgqubwhwsa-l | ||
| + | * molecular-weight: | ||
| + | ** 603.329 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-1882]] | ||
| + | * [[RXN4FS-12]] | ||
| + | * [[RXN4FS-13]] | ||
| + | * [[RXNQT-4141]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1882]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gdp-β-l-galactose}} |
| + | {{#set: inchi-key=inchikey=mvmscbbuihutgj-jgqubwhwsa-l}} | ||
| + | {{#set: molecular-weight=603.329}} | ||
Revision as of 18:56, 14 January 2021
Contents
Metabolite GDP-L-GALACTOSE
- common-name:
- gdp-β-l-galactose
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
- inchi-key:
- mvmscbbuihutgj-jgqubwhwsa-l
- molecular-weight:
- 603.329
