Difference between revisions of "16S-rRNA-N7-methylguanine527"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14596 == * transcription-direction: ** negative * right-end-position: ** 164856 * left-end-position: ** 141669 * centisome-position: ** 45.467937...")
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14596 ==
+
== Metabolite INDOXYL ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** indoxyl
−
* right-end-position:
+
* smiles:
−
** 164856
+
** c2(c=cc1(=c(c(o)=cn1)c=2))
−
* left-end-position:
+
* inchi-key:
−
** 141669
+
** pckpvgolpkluhr-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 45.467937   
+
** 133.149
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15587]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
+
* [[RXN-15587]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=indoxyl}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=pckpvgolpkluhr-uhfffaoysa-n}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=133.149}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-4041]]
 
−
** '''5''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7942]]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=164856}}
 
−
{{#set: left-end-position=141669}}
 
−
{{#set: centisome-position=45.467937    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:34, 18 December 2020

Metabolite INDOXYL

  • common-name:
    • indoxyl
  • smiles:
    • c2(c=cc1(=c(c(o)=cn1)c=2))
  • inchi-key:
    • pckpvgolpkluhr-uhfffaoysa-n
  • molecular-weight:
    • 133.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=16S-rRNA-N7-methylguanine527&oldid=47195"