Difference between revisions of "16S-rRNA-adenine1518-adenine1519"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLYCEROPHOSPHOGLYCEROL == * common-name: ** glycerophosphoglycerol * smiles: ** c(c(cop(occ(co)o)([o-])=o)o)o * inchi-key: ** llcsxhmjulh...")
(Created page with "Category:metabolite == Metabolite 16S-rRNA-adenine1518-adenine1519 == * common-name: ** adenine1518/adenine1519 in 16s rrna == Reaction(s) known to consume the compound ==...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLYCEROPHOSPHOGLYCEROL ==
+
== Metabolite 16S-rRNA-adenine1518-adenine1519 ==
 
* common-name:
 
* common-name:
** glycerophosphoglycerol
+
** adenine1518/adenine1519 in 16s rrna
* smiles:
 
** c(c(cop(occ(co)o)([o-])=o)o)o
 
* inchi-key:
 
** llcsxhmjulhsjn-uhfffaoysa-m
 
* molecular-weight:
 
** 245.146
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14073]]
+
* [[RXN-11633]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycerophosphoglycerol}}
+
{{#set: common-name=adenine1518/adenine1519 in 16s rrna}}
{{#set: inchi-key=inchikey=llcsxhmjulhsjn-uhfffaoysa-m}}
 
{{#set: molecular-weight=245.146}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 16S-rRNA-adenine1518-adenine1519

  • common-name:
    • adenine1518/adenine1519 in 16s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality