Difference between revisions of "16S-rRNA-cytidine1402"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-135 == * common-name: ** trans-neoxanthin * smiles: ** cc(c=cc=c(c)[ch]=c=c1(c(o)(c)cc(o)cc(c)(c)1))=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)...") |
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15924 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-oleoyl-2-lyso-glycerone phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yzkfnnqaebncen-ktkrtigzsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 432.493 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15044]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-oleoyl-2-lyso-glycerone phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yzkfnnqaebncen-ktkrtigzsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=432.493}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-15924
- common-name:
- 1-oleoyl-2-lyso-glycerone phosphate
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
- inchi-key:
- yzkfnnqaebncen-ktkrtigzsa-l
- molecular-weight:
- 432.493
