Difference between revisions of "16S-rRNA-cytidine1402"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite 16S-rRNA-cytidine1402 == * common-name: ** a cytidine1402 in 16s rrna == Reaction(s) known to consume the compound == * RXN-11637 * [...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 16S-rRNA-cytidine1402 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cytidine1402 in 16s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11637]] | ||
| + | * [[RXN-11638]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cytidine1402 in 16s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 16S-rRNA-cytidine1402
- common-name:
- a cytidine1402 in 16s rrna
