Difference between revisions of "16S-rRNA-guanine-527"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15692 == * common-name: ** (3e)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...") |
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GDP-TP == |
* common-name: | * common-name: | ||
− | ** | + | ** pppgpp |
* smiles: | * smiles: | ||
− | ** | + | ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kcpmacxzaitqax-uuokfmhzsa-h |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 677.095 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-6427]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[GTPPYPHOSKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pppgpp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=677.095}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite GDP-TP
- common-name:
- pppgpp
- smiles:
- c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- kcpmacxzaitqax-uuokfmhzsa-h
- molecular-weight:
- 677.095