Difference between revisions of "16S-rRNA-guanine-527"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15692 == * common-name: ** (3e)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15692 ==
+
== Metabolite GDP-TP ==
 
* common-name:
 
* common-name:
** (3e)-dec-3-enoyl-coa
+
** pppgpp
 
* smiles:
 
* smiles:
** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** cqgvnmqhzqjnii-zjzqahhtsa-j
+
** kcpmacxzaitqax-uuokfmhzsa-h
 
* molecular-weight:
 
* molecular-weight:
** 915.738
+
** 677.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6427]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14803]]
+
* [[GTPPYPHOSKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3e)-dec-3-enoyl-coa}}
+
{{#set: common-name=pppgpp}}
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-zjzqahhtsa-j}}
+
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
{{#set: molecular-weight=915.738}}
+
{{#set: molecular-weight=677.095}}

Revision as of 15:25, 5 January 2021

Metabolite GDP-TP

  • common-name:
    • pppgpp
  • smiles:
    • c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • kcpmacxzaitqax-uuokfmhzsa-h
  • molecular-weight:
    • 677.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality