Difference between revisions of "16S-rRNA-guanine1516"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=c...")
(Created page with "Category:metabolite == Metabolite 16S-rRNA-guanine1516 == * common-name: ** a guanine1516 in 16s rrna == Reaction(s) known to consume the compound == * RXN0-6731 == Re...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12117 ==
+
== Metabolite 16S-rRNA-guanine1516 ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-7
+
** a guanine1516 in 16s rrna
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
** ufzdimbxtvrbds-ssqlmynasa-n
 
* molecular-weight:
 
** 636.999
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9191]]
+
* [[RXN0-6731]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-7}}
+
{{#set: common-name=a guanine1516 in 16s rrna}}
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
 
{{#set: molecular-weight=636.999}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 16S-rRNA-guanine1516

  • common-name:
    • a guanine1516 in 16s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality