Difference between revisions of "17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-444 == * common-name: ** s-(methyl-5-thio-α-d-ribose 1-phosphate * smiles: ** cscc1(oc(op([o-])(=o)[o-])c(c1o)o) * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite 17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O == * common-name: ** 17-β-hydroxy-5-α-androstan-3-one * smiles: ** cc34([ch]2([ch]([ch]1(...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-444 ==
+
== Metabolite 17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O ==
 
* common-name:
 
* common-name:
** s-(methyl-5-thio-α-d-ribose 1-phosphate
+
** 17-β-hydroxy-5-α-androstan-3-one
 
* smiles:
 
* smiles:
** cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
+
** cc34([ch]2([ch]([ch]1(c(c)(c(o)cc1)cc2))cc[ch]3cc(=o)cc4))
 
* inchi-key:
 
* inchi-key:
** jtfittqbrjdstl-kvtdhhqdsa-l
+
** nvkawkqgwwiwpm-abevxsgrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 258.182
+
** 290.445
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[5.3.1.23-RXN]]
 
* [[M5TRPI]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[M5TAP]]
+
* [[RXN66-343]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(methyl-5-thio-α-d-ribose 1-phosphate}}
+
{{#set: common-name=17-β-hydroxy-5-α-androstan-3-one}}
{{#set: inchi-key=inchikey=jtfittqbrjdstl-kvtdhhqdsa-l}}
+
{{#set: inchi-key=inchikey=nvkawkqgwwiwpm-abevxsgrsa-n}}
{{#set: molecular-weight=258.182}}
+
{{#set: molecular-weight=290.445}}

Latest revision as of 11:11, 18 March 2021

Metabolite 17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O

  • common-name:
    • 17-β-hydroxy-5-α-androstan-3-one
  • smiles:
    • cc34([ch]2([ch]([ch]1(c(c)(c(o)cc1)cc2))cc[ch]3cc(=o)cc4))
  • inchi-key:
    • nvkawkqgwwiwpm-abevxsgrsa-n
  • molecular-weight:
    • 290.445

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality