Difference between revisions of "17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-CYS-tRNAs == * common-name: ** an l-cysteinyl-[trnacys] == Reaction(s) known to consume the compound == * RXN-16637 == Reacti...") |
(Created page with "Category:metabolite == Metabolite CPD-444 == * common-name: ** s-(methyl-5-thio-α-d-ribose 1-phosphate * smiles: ** cscc1(oc(op([o-])(=o)[o-])c(c1o)o) * inchi-key: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-444 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-(methyl-5-thio-α-d-ribose 1-phosphate |
| + | * smiles: | ||
| + | ** cscc1(oc(op([o-])(=o)[o-])c(c1o)o) | ||
| + | * inchi-key: | ||
| + | ** jtfittqbrjdstl-kvtdhhqdsa-l | ||
| + | * molecular-weight: | ||
| + | ** 258.182 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[5.3.1.23-RXN]] |
| + | * [[M5TRPI]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[M5TAP]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-(methyl-5-thio-α-d-ribose 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=jtfittqbrjdstl-kvtdhhqdsa-l}} | ||
| + | {{#set: molecular-weight=258.182}} | ||
Revision as of 15:24, 5 January 2021
Contents
Metabolite CPD-444
- common-name:
- s-(methyl-5-thio-α-d-ribose 1-phosphate
- smiles:
- cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
- inchi-key:
- jtfittqbrjdstl-kvtdhhqdsa-l
- molecular-weight:
- 258.182
