Difference between revisions of "18S-rRNA-adenine1779-adenine1780"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIPHTINE == * common-name: ** a diphthine-[translation elongation factor 2] == Reaction(s) known to consume the compound == * DIPHTINE-...")
(Created page with "Category:metabolite == Metabolite CPD-17402 == * common-name: ** (3r)-hydroxy-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIPHTINE ==
+
== Metabolite CPD-17402 ==
 
* common-name:
 
* common-name:
** a diphthine-[translation elongation factor 2]
+
** (3r)-hydroxy-auricoloyl-coa
 +
* smiles:
 +
** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** xtsclycoojhttr-ktfrusdtsa-j
 +
* molecular-weight:
 +
** 1085.989
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
+
* [[RXN-16155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11373]]
+
* [[RXN-16154]]
* [[RXN-14326]]
 
* [[RXN-15776]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a diphthine-[translation elongation factor 2]}}
+
{{#set: common-name=(3r)-hydroxy-auricoloyl-coa}}
 +
{{#set: inchi-key=inchikey=xtsclycoojhttr-ktfrusdtsa-j}}
 +
{{#set: molecular-weight=1085.989}}

Revision as of 11:12, 15 January 2021

Metabolite CPD-17402

  • common-name:
    • (3r)-hydroxy-auricoloyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xtsclycoojhttr-ktfrusdtsa-j
  • molecular-weight:
    • 1085.989

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality