Difference between revisions of "18S-rRNA-adenine1779-adenine1780"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17402 == * common-name: ** (3r)-hydroxy-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
(Created page with "Category:metabolite == Metabolite N-Acylethanolamines == * common-name: ** an n-acylethanolamine == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17402 ==
+
== Metabolite N-Acylethanolamines ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-auricoloyl-coa
+
** an n-acylethanolamine
* smiles:
 
** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** xtsclycoojhttr-ktfrusdtsa-j
 
* molecular-weight:
 
** 1085.989
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16155]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16154]]
+
* [[RXN-12116]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-auricoloyl-coa}}
+
{{#set: common-name=an n-acylethanolamine}}
{{#set: inchi-key=inchikey=xtsclycoojhttr-ktfrusdtsa-j}}
 
{{#set: molecular-weight=1085.989}}
 

Revision as of 08:24, 15 March 2021

Metabolite N-Acylethanolamines

  • common-name:
    • an n-acylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality