Difference between revisions of "18S-rRNA-adenine1779-adenine1780"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20486 == * transcription-direction: ** positive * right-end-position: ** 389770 * left-end-position: ** 366758 * centisome-position: ** 59.343742...")
(Created page with "Category:metabolite == Metabolite INDOLE_PYRUVATE == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** rstklpzezyg...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ20486 ==
+
== Metabolite INDOLE_PYRUVATE ==
* transcription-direction:
+
* common-name:
** positive
+
** (indol-3-yl)pyruvate
* right-end-position:
+
* smiles:
** 389770
+
** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
* left-end-position:
+
* inchi-key:
** 366758
+
** rstklpzezygqpy-uhfffaoysa-m
* centisome-position:
+
* molecular-weight:
** 59.343742   
+
** 202.189
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXNDQC-2]]
== Reaction(s) associated ==
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
* [[LACCASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-17351]]
+
{{#set: common-name=(indol-3-yl)pyruvate}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=rstklpzezygqpy-uhfffaoysa-m}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=202.189}}
== Pathway(s) associated ==
 
* [[PWY-5469]]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-5466]]
 
** '''2''' reactions found over '''10''' reactions in the full pathway
 
* [[PWY-6824]]
 
** '''2''' reactions found over '''10''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=389770}}
 
{{#set: left-end-position=366758}}
 
{{#set: centisome-position=59.343742    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=3}}
 

Revision as of 20:30, 18 December 2020

Metabolite INDOLE_PYRUVATE

  • common-name:
    • (indol-3-yl)pyruvate
  • smiles:
    • c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
  • inchi-key:
    • rstklpzezygqpy-uhfffaoysa-m
  • molecular-weight:
    • 202.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality