Difference between revisions of "18S-rRNA-adenine1779-adenine1780"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE_PYRUVATE == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** rstklpzezyg...") |
(Created page with "Category:metabolite == Metabolite Xyloglucans-Galactose-23 == * common-name: ** an xllg xylogulcan == Reaction(s) known to consume the compound == * RXN-9463 == Reacti...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Xyloglucans-Galactose-23 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an xllg xylogulcan |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9463]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an xllg xylogulcan}} |
| − | |||
| − | |||
Revision as of 14:53, 5 January 2021
Contents
Metabolite Xyloglucans-Galactose-23
- common-name:
- an xllg xylogulcan
