Difference between revisions of "18S-rRNA-pseudouridine-1191"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite Charged-ARG-tRNAs == * common-name: ** an l-arginyl-[trnaarg] == Reaction(s) known to consume the compound == * [[ARGINYLTRANSFERASE-RXN]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Charged-ARG-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an l-arginyl-[trnaarg] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ARGINYLTRANSFERASE-RXN]] |
| + | * [[RXN-17888]] | ||
| + | * [[RXN-17889]] | ||
| + | * [[RXN-17890]] | ||
| + | * [[RXN-17891]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ARGININE--TRNA-LIGASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an l-arginyl-[trnaarg]}} |
| − | |||
| − | |||
Revision as of 11:16, 15 January 2021
Contents
Metabolite Charged-ARG-tRNAs
- common-name:
- an l-arginyl-[trnaarg]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-arginyl-[trnaarg" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
