Difference between revisions of "18S-rRNA-pseudouridine-1191"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...")
(Created page with "Category:metabolite == Metabolite 18S-rRNA-pseudouridine-1191 == * common-name: ** an 18s rrna pseudouridine1191 == Reaction(s) known to consume the compound == * RXN-13...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INDOXYL ==
+
== Metabolite 18S-rRNA-pseudouridine-1191 ==
 
* common-name:
 
* common-name:
** indoxyl
+
** an 18s rrna pseudouridine1191
* smiles:
 
** c2(c=cc1(=c(c(o)=cn1)c=2))
 
* inchi-key:
 
** pckpvgolpkluhr-uhfffaoysa-n
 
* molecular-weight:
 
** 133.149
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15587]]
+
* [[RXN-13327]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15587]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=indoxyl}}
+
{{#set: common-name=an 18s rrna pseudouridine1191}}
{{#set: inchi-key=inchikey=pckpvgolpkluhr-uhfffaoysa-n}}
 
{{#set: molecular-weight=133.149}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 18S-rRNA-pseudouridine-1191

  • common-name:
    • an 18s rrna pseudouridine1191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality