Difference between revisions of "2-3-4-Saturated-L-Phosphatidates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...")
(Created page with "Category:metabolite == Metabolite CPD1F-133 == * common-name: ** violaxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12461 ==
+
== Metabolite CPD1F-133 ==
 +
* common-name:
 +
** violaxanthin
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
+
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
* common-name:
+
* inchi-key:
** tri-trans,hepta-cis-undecaprenyl diphosphate
+
** szcbxwmuopqsox-wvjdlnglsa-n
 
* molecular-weight:
 
* molecular-weight:
** 924.251
+
** 600.88
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13185]]
 +
* [[RXN-7984]]
 +
* [[RXN1F-155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11488]]
+
* [[RXN-13185]]
 +
* [[RXN-7979]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}}
+
{{#set: common-name=violaxanthin}}
{{#set: molecular-weight=924.251}}
+
{{#set: inchi-key=inchikey=szcbxwmuopqsox-wvjdlnglsa-n}}
 +
{{#set: molecular-weight=600.88}}

Revision as of 11:13, 15 January 2021

Metabolite CPD1F-133

  • common-name:
    • violaxanthin
  • smiles:
    • cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
  • inchi-key:
    • szcbxwmuopqsox-wvjdlnglsa-n
  • molecular-weight:
    • 600.88

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality