Difference between revisions of "2-3-4-Saturated-L-Phosphatidates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...")
(Created page with "Category:metabolite == Metabolite 2-3-4-Saturated-L-Phosphatidates == * common-name: ** a 1,2-diacyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound =...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12461 ==
+
== Metabolite 2-3-4-Saturated-L-Phosphatidates ==
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
 
 
* common-name:
 
* common-name:
** tri-trans,hepta-cis-undecaprenyl diphosphate
+
** a 1,2-diacyl-sn-glycerol 3-phosphate
* molecular-weight:
 
** 924.251
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5515]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11488]]
+
* [[RXN0-5514]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}}
+
{{#set: common-name=a 1,2-diacyl-sn-glycerol 3-phosphate}}
{{#set: molecular-weight=924.251}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 2-3-4-Saturated-L-Phosphatidates

  • common-name:
    • a 1,2-diacyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality