Difference between revisions of "2-3-4-Saturated-L-Phosphatidates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE == * common-name: ** (s)-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(cc(=nc(c1)c([o-])=o)c([o-])=...")
(Created page with "Category:metabolite == Metabolite CPD-19013 == * common-name: ** 2-methylpropane-1,2-diol * smiles: ** cc(o)(c)co * inchi-key: ** btvwzwfkmiusgs-uhfffaoysa-n * molecular-w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE ==
+
== Metabolite CPD-19013 ==
 
* common-name:
 
* common-name:
** (s)-2,3,4,5-tetrahydrodipicolinate
+
** 2-methylpropane-1,2-diol
 
* smiles:
 
* smiles:
** c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
+
** cc(o)(c)co
 
* inchi-key:
 
* inchi-key:
** cxmbcxqhoxuceo-bypyzucnsa-l
+
** btvwzwfkmiusgs-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 169.137
+
** 90.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14246]]
 
* [[RXN-7737]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14014]]
+
* [[RXN-17589]]
* [[RXN-14246]]
 
* [[RXN-7737]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-2,3,4,5-tetrahydrodipicolinate}}
+
{{#set: common-name=2-methylpropane-1,2-diol}}
{{#set: inchi-key=inchikey=cxmbcxqhoxuceo-bypyzucnsa-l}}
+
{{#set: inchi-key=inchikey=btvwzwfkmiusgs-uhfffaoysa-n}}
{{#set: molecular-weight=169.137}}
+
{{#set: molecular-weight=90.122}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-19013

  • common-name:
    • 2-methylpropane-1,2-diol
  • smiles:
    • cc(o)(c)co
  • inchi-key:
    • btvwzwfkmiusgs-uhfffaoysa-n
  • molecular-weight:
    • 90.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality