Difference between revisions of "2-3-4-Saturated-L-Phosphatidates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ASN-tRNAs == * common-name: ** trnaasn == Reaction(s) known to consume the compound == * ASPARAGINE--TRNA-LIGASE-RXN == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12461 == |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c | ||
* common-name: | * common-name: | ||
| − | ** | + | ** tri-trans,hepta-cis-undecaprenyl diphosphate |
| + | * molecular-weight: | ||
| + | ** 924.251 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11488]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}} |
| + | {{#set: molecular-weight=924.251}} | ||
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-12461
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
- common-name:
- tri-trans,hepta-cis-undecaprenyl diphosphate
- molecular-weight:
- 924.251
