Difference between revisions of "2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-7-DIMETHYLXANTHINE == * common-name: ** paraxanthine * smiles: ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) * inchi-key: ** qunwudvfrngtco-uhff...") |
(Created page with "Category:metabolite == Metabolite 2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE == * common-name: ** a 2-[(3s)-3-amino-3-carboxypropyl]-l-histidine-[translation elongation factor...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-[(3s)-3-amino-3-carboxypropyl]-l-histidine-[translation elongation factor 2] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11370]] |
| + | * [[RXN-14326]] | ||
| + | * [[RXN-15775]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11371]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-[(3s)-3-amino-3-carboxypropyl]-l-histidine-[translation elongation factor 2]}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE
- common-name:
- a 2-[(3s)-3-amino-3-carboxypropyl]-l-histidine-[translation elongation factor 2]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 2-[(3s)-3-amino-3-carboxypropyl]-l-histidine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
