Difference between revisions of "2-3-DIHYDROXYBENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...") |
(Created page with "Category:metabolite == Metabolite 2-3-DIHYDROXYBENZOATE == * common-name: ** 2,3-dihydroxybenzoate * smiles: ** c(c1(=cc=cc(=c1o)o))([o-])=o * inchi-key: ** gldqamycgoijdv...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-3-DIHYDROXYBENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,3-dihydroxybenzoate |
* smiles: | * smiles: | ||
| − | ** cc | + | ** c(c1(=cc=cc(=c1o)o))([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gldqamycgoijdv-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 153.114 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DHBDEHYD-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,3-dihydroxybenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gldqamycgoijdv-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=153.114}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 2-3-DIHYDROXYBENZOATE
- common-name:
- 2,3-dihydroxybenzoate
- smiles:
- c(c1(=cc=cc(=c1o)o))([o-])=o
- inchi-key:
- gldqamycgoijdv-uhfffaoysa-m
- molecular-weight:
- 153.114
