Difference between revisions of "2-ACETO-2-HYDROXY-BUTYRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BENZOYLSUCCINYL-COA == * common-name: ** benzoylsuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite 2-ACETO-2-HYDROXY-BUTYRATE == * common-name: ** (s)-2-aceto-2-hydroxybutanoate * smiles: ** ccc(o)(c(=o)[o-])c(c)=o * inchi-key: ** vuqlh...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite BENZOYLSUCCINYL-COA ==
+
== Metabolite 2-ACETO-2-HYDROXY-BUTYRATE ==
 
* common-name:
 
* common-name:
−
** benzoylsuccinyl-coa
+
** (s)-2-aceto-2-hydroxybutanoate
 
* smiles:
 
* smiles:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** ccc(o)(c(=o)[o-])c(c)=o
 
* inchi-key:
 
* inchi-key:
−
** sgnpjinsckfitg-ihebcorqsa-i
+
** vuqlhqfkacohnz-lurjtmiesa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 966.676
+
** 145.135
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETOOHBUTREDUCTOISOM-RXN]]
 +
* [[RXN-14106]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-905]]
+
* [[RXN-14106]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=benzoylsuccinyl-coa}}
+
{{#set: common-name=(s)-2-aceto-2-hydroxybutanoate}}
−
{{#set: inchi-key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}}
+
{{#set: inchi-key=inchikey=vuqlhqfkacohnz-lurjtmiesa-m}}
−
{{#set: molecular-weight=966.676}}
+
{{#set: molecular-weight=145.135}}

Latest revision as of 11:12, 18 March 2021

Metabolite 2-ACETO-2-HYDROXY-BUTYRATE

  • common-name:
    • (s)-2-aceto-2-hydroxybutanoate
  • smiles:
    • ccc(o)(c(=o)[o-])c(c)=o
  • inchi-key:
    • vuqlhqfkacohnz-lurjtmiesa-m
  • molecular-weight:
    • 145.135

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-ACETO-2-HYDROXY-BUTYRATE&oldid=137282"