Difference between revisions of "2-ACETO-2-HYDROXY-BUTYRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14668 == * transcription-direction: ** negative * right-end-position: ** 142204 * left-end-position: ** 120668 * centisome-position: ** 38.84509...")
(Created page with "Category:metabolite == Metabolite CPD-14675 == * common-name: ** pristanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14668 ==
+
== Metabolite CPD-14675 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** pristanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 142204
+
** cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 120668
+
** xyjpsqpvcbnzht-tukysrjdsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 38.84509   
+
** 1043.995
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN66-484]]
−
* [[PEPCARBOXYKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=pristanoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=xyjpsqpvcbnzht-tukysrjdsa-j}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=1043.995}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7117]]
 
−
** '''10''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-561]]
 
−
** '''6''' reactions found over '''4''' reactions in the full pathway
 
−
* [[GLUCONEO-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=142204}}
 
−
{{#set: left-end-position=120668}}
 
−
{{#set: centisome-position=38.84509    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-14675

  • common-name:
    • pristanoyl-coa
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xyjpsqpvcbnzht-tukysrjdsa-j
  • molecular-weight:
    • 1043.995

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-ACETO-2-HYDROXY-BUTYRATE&oldid=46098"