Difference between revisions of "2-ACETO-LACTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5923 == * common-name: ** 5'-deoxy-5'-fluoroadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f * inchi-key: ** qp...")
(Created page with "Category:metabolite == Metabolite Charged-fMET-tRNAs == * common-name: ** an n-formyl-l-methionylaminoacyl-trna == Reaction(s) known to consume the compound == * 3.5.1.2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-5923 ==
+
== Metabolite Charged-fMET-tRNAs ==
 
* common-name:
 
* common-name:
** 5'-deoxy-5'-fluoroadenosine
+
** an n-formyl-l-methionylaminoacyl-trna
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f
 
* inchi-key:
 
** qpvlkmicbyrpsx-kqynxxcusa-n
 
* molecular-weight:
 
** 269.235
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11743]]
+
* [[3.5.1.27-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5'-deoxy-5'-fluoroadenosine}}
+
{{#set: common-name=an n-formyl-l-methionylaminoacyl-trna}}
{{#set: inchi-key=inchikey=qpvlkmicbyrpsx-kqynxxcusa-n}}
 
{{#set: molecular-weight=269.235}}
 

Revision as of 08:32, 15 March 2021

Metabolite Charged-fMET-tRNAs

  • common-name:
    • an n-formyl-l-methionylaminoacyl-trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality