Difference between revisions of "2-ACYL-GPE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...") |
(Created page with "Category:metabolite == Metabolite 2-ACYL-GPE == * common-name: ** a 2-acyl-1-lyso-phosphatidylethanolamine == Reaction(s) known to consume the compound == == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-ACYL-GPE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-acyl-1-lyso-phosphatidylethanolamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-6952]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-acyl-1-lyso-phosphatidylethanolamine}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 2-ACYL-GPE
- common-name:
- a 2-acyl-1-lyso-phosphatidylethanolamine
