Difference between revisions of "2-ACYL-GPE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11525 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)cc...")
(Created page with "Category:metabolite == Metabolite METHYLARSONATE == * common-name: ** methylarsonate * smiles: ** c[as](=o)([o-])o * inchi-key: ** qypprtnmgcreim-uhfffaoysa-m * molecular-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11525 ==
+
== Metabolite METHYLARSONATE ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
+
** methylarsonate
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
+
** c[as](=o)([o-])o
 
* inchi-key:
 
* inchi-key:
** yyuzysvpfvoylb-rguwmiccsa-j
+
** qypprtnmgcreim-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 983.813
+
** 138.962
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10707]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10700]]
+
* [[2.1.1.137-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}}
+
{{#set: common-name=methylarsonate}}
{{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}}
+
{{#set: inchi-key=inchikey=qypprtnmgcreim-uhfffaoysa-m}}
{{#set: molecular-weight=983.813}}
+
{{#set: molecular-weight=138.962}}

Revision as of 13:09, 14 January 2021

Metabolite METHYLARSONATE

  • common-name:
    • methylarsonate
  • smiles:
    • c[as](=o)([o-])o
  • inchi-key:
    • qypprtnmgcreim-uhfffaoysa-m
  • molecular-weight:
    • 138.962

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality