Difference between revisions of "2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite mature-tRNA == * common-name: ** mature trna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-11641 == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) * inchi-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11641 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylumbelliferyl glucoside |
| + | * smiles: | ||
| + | ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) | ||
| + | * inchi-key: | ||
| + | ** yudptgpsbjvhcn-ymiltqatsa-n | ||
| + | * molecular-weight: | ||
| + | ** 338.313 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10769]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylumbelliferyl glucoside}} |
| + | {{#set: inchi-key=inchikey=yudptgpsbjvhcn-ymiltqatsa-n}} | ||
| + | {{#set: molecular-weight=338.313}} | ||
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-11641
- common-name:
- 4-methylumbelliferyl glucoside
- smiles:
- cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3))
- inchi-key:
- yudptgpsbjvhcn-ymiltqatsa-n
- molecular-weight:
- 338.313
