Difference between revisions of "2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LIPOYL-AMP == * common-name: ** lipoyl-adenylate * smiles: ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=...")
(Created page with "Category:metabolite == Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI == * common-name: ** aminocarboxymuconate semialdehyde * smiles: ** c(=o)([o-])c(=c(c([o-])=o)n)c=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite LIPOYL-AMP ==
+
== Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI ==
 
* common-name:
 
* common-name:
−
** lipoyl-adenylate
+
** aminocarboxymuconate semialdehyde
 
* smiles:
 
* smiles:
−
** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
+
** c(=o)([o-])c(=c(c([o-])=o)n)c=c[ch]=o
 
* inchi-key:
 
* inchi-key:
−
** qwegocjrzoksoe-aduakinbsa-m
+
** kacpvqqhdvbvfc-pmrvsphwsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 534.518
+
** 183.12
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13039]]
+
* [[AMINO-CARBOXYMUCONATE-SEMIALDEHYDE-RXN]]
−
* [[RXN-8655]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-8654]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=lipoyl-adenylate}}
+
{{#set: common-name=aminocarboxymuconate semialdehyde}}
−
{{#set: inchi-key=inchikey=qwegocjrzoksoe-aduakinbsa-m}}
+
{{#set: inchi-key=inchikey=kacpvqqhdvbvfc-pmrvsphwsa-l}}
−
{{#set: molecular-weight=534.518}}
+
{{#set: molecular-weight=183.12}}

Latest revision as of 11:12, 18 March 2021

Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI

  • common-name:
    • aminocarboxymuconate semialdehyde
  • smiles:
    • c(=o)([o-])c(=c(c([o-])=o)n)c=c[ch]=o
  • inchi-key:
    • kacpvqqhdvbvfc-pmrvsphwsa-l
  • molecular-weight:
    • 183.12

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI&oldid=137316"